CAS 41708-76-3
:(+)-Indicine N-oxide
Description:
(+)-Indicine N-oxide, with the CAS number 41708-76-3, is a chemical compound that belongs to the class of alkaloids. It is characterized by its unique molecular structure, which includes a nitrogen atom in an oxidized state, contributing to its reactivity and biological activity. This compound is typically derived from natural sources, particularly certain plant species, and is known for its potential pharmacological properties. (+)-Indicine N-oxide exhibits a chiral center, which means it can exist in two enantiomeric forms, with the (+) designation indicating its specific optical activity. The compound is often studied for its effects on various biological systems, including its potential role in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, making it important to consider these factors in experimental applications. Overall, (+)-Indicine N-oxide represents a significant area of interest in both organic chemistry and pharmacology due to its complex structure and potential therapeutic uses.
Formula:C15H25NO6
InChI:InChI=1S/C15H25NO6/c1-9(2)15(20,10(3)17)14(19)22-8-11-4-6-16(21)7-5-12(18)13(11)16/h4,9-10,12-13,17-18,20H,5-8H2,1-3H3/t10-,12+,13+,15+,16?/m0/s1
InChI key:InChIKey=DNAWGBOKUFFVMB-PZIGJSDBSA-N
SMILES:O=N12[C@](C(COC([C@@](C(C)C)([C@H](C)O)O)=O)=CC1)([C@H](O)CC2)[H]
Synonyms:- (+)-Indicine N-oxide
- Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, (2,3,5,7a-tetrahydro-1-hydroxy-1H-pyrrolizin-7-yl)methyl ester, N-oxide, [1R-[1α,7(2R*,3S*),7aβ]]-
- Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, (2,3,5,7a-tetrahydro-1-hydroxy-4-oxido-1H-pyrrolizin-7-yl)methyl ester
- Butanoic acid, 2,3-dihydroxy-2-(1-methylethyl)-, [(1R,7aS)-2,3,5,7a-tetrahydro-1-hydroxy-4-oxido-1H-pyrrolizin-7-yl]methyl ester, (2R,3S)-
- NSC 132319
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Indicine N-oxide
CAS:Indicine N-oxide (NSC 132319), a pyrrolizidine alkaloid, serves as an antitumor agent in pediatric cancer and solid tumors research.Formula:C15H25NO6Color and Shape:SolidMolecular weight:315.37Indicine n-oxide
CAS:Natural alkaloidFormula:C15H25NO6Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:315.37Indicine-N-oxide
CAS:Indicine-N-Oxide is an antitumour agent that belongs to the group of medicines. It acts as a chromatographic and mass spectrometric agent. Indicine-N-Oxide has been shown to have antitumour activity against rat hepatomas in mice. This drug is also used for the treatment of hypercalcemia, which may be due to its ability to increase the excretion of potassium levels in urine. Indicine-N-Oxide has also been found to have cardiac glycoside and heliotropium properties, which may cause allergic reactions in some people.Formula:C15H25NO6Purity:Min. 95%Color and Shape:PowderMolecular weight:315.36 g/molIndicine N-Oxide-D7
CAS:Controlled ProductFormula:C15D7H18NO6Color and Shape:NeatMolecular weight:322.405Ref: 4Z-I-143003
Discontinued product




