
CAS 41708-94-5: Chitopentaose
Description:Chitopentaose is a carbohydrate composed of five N-acetylglucosamine (GlcNAc) units linked by β(1→4) glycosidic bonds, making it a type of oligosaccharide derived from chitin, a natural polymer found in the exoskeletons of crustaceans and the cell walls of fungi. This compound is characterized by its structural similarity to chitosan, which is a deacetylated derivative of chitin. Chitopentaose exhibits various biological activities, including potential prebiotic effects, as it can stimulate the growth of beneficial gut bacteria. Additionally, it has applications in biotechnology and medicine, particularly in drug delivery systems and as a biocompatible material. Its solubility in water and ability to form gels or films under certain conditions further enhance its utility in various fields. The CAS number 41708-94-5 uniquely identifies this substance, facilitating its recognition in scientific literature and regulatory contexts. Overall, chitopentaose represents a significant area of interest in carbohydrate chemistry and its applications in health and industry.
Formula:C30H57N5O21
InChI:InChI=1S/C30H57N5O21/c31-7(1-36)17(43)23(8(42)2-37)53-28-14(33)20(46)25(10(4-39)50-28)55-30-16(35)22(48)26(12(6-41)52-30)56-29-15(34)21(47)24(11(5-40)51-29)54-27-13(32)19(45)18(44)9(3-38)49-27/h1,7-30,37-48H,2-6,31-35H2/t7-,8+,9+,10+,11+,12+,13+,14+,15+,16+,17+,18+,19+,20+,21+,22+,23+,24+,25+,26+,27-,28-,29-,30-/m0/s1
InChI key:InChIKey=QWJDZWJRVXIXQW-NXGGGWQFSA-N
SMILES:O=CC(N)C(O)C(OC1OC(CO)C(OC2OC(CO)C(OC3OC(CO)C(OC4OC(CO)C(O)C(O)C4N)C(O)C3N)C(O)C2N)C(O)C1N)C(O)CO
- Synonyms:
- Chitopentose
- D-Glucose, O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-2-amino-2-deoxy-
- O-2-Amino-2-deoxy-β-D-glucopyranosyl-(1→4)-O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-O-2-amino-2-deoxy-β-D-glucopyranosyl-(1→4)-2-amino-2-deoxy-D-glucose
- Chitopentaose
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Chitopentaose Pentahydrochloride REF: 3B-C3678CAS: | >95.0%(T)(HPLC) | 417.00 € | Tue 22 Apr 25 |

Chitopentaose Pentahydrochloride
Ref: 3B-C3678
25mg | 417.00 € |