CAS 41710-89-8
:2-(Tetradecyloxy)benzenamine
Description:
2-(Tetradecyloxy)benzenamine, with the CAS number 41710-89-8, is an organic compound characterized by its long hydrophobic tetradecyl chain attached to an amino-substituted aromatic ring. This structure imparts both hydrophobic and hydrophilic properties, making it amphiphilic. The tetradecyl group enhances its solubility in non-polar solvents, while the amino group can engage in hydrogen bonding, allowing for potential solubility in polar solvents as well. This compound is typically used in various applications, including surfactants, emulsifiers, and as a potential intermediate in organic synthesis. Its properties may include a relatively high melting point due to the long alkyl chain, and it may exhibit surface-active behavior, which can be beneficial in formulations requiring stabilization of emulsions or dispersions. Additionally, the presence of the amino group may allow for further functionalization, making it versatile in chemical reactions. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or environmental impact.
Formula:C20H35NO
InChI:InChI=1S/C20H35NO/c1-2-3-4-5-6-7-8-9-10-11-12-15-18-22-20-17-14-13-16-19(20)21/h13-14,16-17H,2-12,15,18,21H2,1H3
InChI key:InChIKey=IXZBAJOADDIGIP-UHFFFAOYSA-N
SMILES:O(CCCCCCCCCCCCCC)C1=C(N)C=CC=C1
Synonyms:- 2-(Tetradecyloxy)aniline
- 2-(Tetradecyloxy)benzenamine
- 2-Tetradecoxyaniline
- Benzenamine, 2-(Tetradecyloxy)-
- O-Tetradecyloxyaniline
- 2-Tetradecyloxyaniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
