CAS 41717-28-6: 2-Benzofurancarbonyl chloride

Description:2-Benzofurancarbonyl chloride, with the CAS number 41717-28-6, is an organic compound characterized by the presence of a benzofuran moiety attached to a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly due to the carbonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis. The presence of the benzofuran structure contributes to its aromatic properties, potentially influencing its solubility and stability in various solvents. Additionally, 2-benzofurancarbonyl chloride may exhibit biological activity, which can be of interest in pharmaceutical research. However, it should be handled with care due to its potential toxicity and reactivity, necessitating appropriate safety precautions during use and storage. Overall, this compound serves as a valuable intermediate in the synthesis of more complex organic molecules.

Formula:C₉H₅ClO₂

InChI:InChI=1S/C9H5ClO2/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H

InChI key:InChIKey=ZJDRDTZQVOCKPI-UHFFFAOYSA-N

SMILES:O=C(Cl)C=1OC=2C=CC=CC2C1

Synonyms:
1-Benzofuran-2-carbonyl chloride
2-Benzo[b]furancarbonyl chloride
2-Benzofurancarbonyl chloride
Benzo[b]furan-2-carbonyl chloride
Benzofuran-2-carboxylic acid chloride
Coumarilic acid chloride
Coumariloyl chloride
NSC 162303

Found 4 products.

Product data	Purity	Price range	Estimated delivery
BENZOFURAN-2-CARBONYL CHLORIDE REF: IN-DA00C02TCAS: 41717-28-6	95%	To inquire	Mon 07 Apr 25
Benzo[b]furan-2-carbonyl chloride REF: 54-OR23094CAS: 41717-28-6	97%	36.00 €~147.00 €	Tue 08 Apr 25
Benzofuran-2-carbonyl chloride REF: 10-F014747CAS: 41717-28-6	95.0%	To inquire	Thu 17 Apr 25
Benzofuran-2-Carbonyl Chloride REF: 3D-FB170453CAS: 41717-28-6	Min. 95%	- - -	Discontinued product