CAS 41736-92-9
:(4R)-4-Hydroxy-1-(1-oxohexadecyl)-L-proline
Description:
(4R)-4-Hydroxy-1-(1-oxohexadecyl)-L-proline, with the CAS number 41736-92-9, is an amino acid derivative characterized by its unique structural features. This compound contains a proline backbone, which is a cyclic amino acid known for its role in protein structure and stability. The presence of a hydroxyl group at the 4-position enhances its solubility and reactivity, while the hexadecyl chain contributes to its hydrophobic characteristics, potentially influencing its interactions in biological systems. The ketone functional group (1-oxo) indicates the presence of a carbonyl group, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may exhibit biological activity, possibly serving as a precursor or intermediate in the synthesis of more complex molecules. Its specific stereochemistry (4R) is crucial for its biological function, as stereoisomers can exhibit different properties and activities. Overall, (4R)-4-Hydroxy-1-(1-oxohexadecyl)-L-proline is of interest in biochemical research and potential pharmaceutical applications due to its structural and functional diversity.
Formula:C21H39NO4
InChI:InChI=1S/C21H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-20(24)22-17-18(23)16-19(22)21(25)26/h18-19,23H,2-17H2,1H3,(H,25,26)/t18-,19+/m1/s1
InChI key:InChIKey=SRHSPJGTSWHUTH-MOPGFXCFSA-N
SMILES:C(CCCCCCCCCCCCCCC)(=O)N1[C@H](C(O)=O)C[C@@H](O)C1
Synonyms:- L-Proline, 4-hydroxy-1-(1-oxohexadecyl)-, trans-
- N-Palmitoylhydroxyproline
- (4R)-4-Hydroxy-1-(1-oxohexadecyl)-L-proline
- L-Proline, 4-hydroxy-1-(1-oxohexadecyl)-, (4R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Hydroxyproline palmitamide
CAS:<p>Hydroxyproline palmitamide is a bioactive chemical.</p>Formula:C21H39NO4Color and Shape:SolidMolecular weight:369.54N-Hexadecanoyl-4-Hydroxyproline
CAS:Controlled ProductFormula:C21H39NO4Color and Shape:NeatMolecular weight:369.539


