CymitQuimica logo

CAS 41736-95-2

:

Spiro[3H-diazirine-3,2′-tricyclo[3.3.1.13,7]decane]

Description:
Spiro[3H-diazirine-3,2′-tricyclo[3.3.1.13,7]decane], with the CAS number 41736-95-2, is a unique chemical compound characterized by its spirocyclic structure, which includes a diazirine moiety. This compound features a tricyclic framework that contributes to its rigidity and stability. The presence of the diazirine group is significant due to its ability to undergo photochemical reactions, particularly upon exposure to ultraviolet light, leading to the formation of reactive intermediates. These intermediates can facilitate various chemical transformations, making the compound useful in applications such as photoaffinity labeling in biochemical research. The compound's structural complexity and the presence of multiple rings may also influence its physical properties, such as solubility and melting point, although specific values can vary based on environmental conditions. Overall, Spiro[3H-diazirine-3,2′-tricyclo[3.3.1.13,7]decane] is of interest in both synthetic chemistry and materials science due to its distinctive features and reactivity.
Formula:C10H14N2
InChI:InChI=1S/C10H14N2/c1-6-2-8-4-7(1)5-9(3-6)10(8)11-12-10/h6-9H,1-5H2
InChI key:InChIKey=PNVXTJMLAFYDOJ-UHFFFAOYSA-N
SMILES:C12(C3CC4CC1CC(C3)C4)N=N2
Synonyms:
  • Spiro[adamantane-2,3′-diazirine]
  • Aziadamantane
  • 2-Adamantane-2,3′-[3H]-diazirine
  • Spiro[3H-diazirine-3,2′-tricyclo[3.3.1.13,7]decane]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.