CAS 41738-72-1

2,2′-Dihydroxy[1,1′-biphenyl]-4,4′-dicarboxylic acid

Description:

2,2′-Dihydroxy[1,1′-biphenyl]-4,4′-dicarboxylic acid, also known by its CAS number 41738-72-1, is an organic compound characterized by its biphenyl structure with hydroxyl and carboxylic acid functional groups. This compound features two hydroxyl groups located at the 2 and 2' positions, and two carboxylic acid groups at the 4 and 4' positions of the biphenyl framework. The presence of these functional groups contributes to its potential as a versatile building block in organic synthesis and materials science. It exhibits properties such as solubility in polar solvents, which is influenced by the hydrogen bonding capabilities of the hydroxyl and carboxylic acid groups. Additionally, the compound may demonstrate antioxidant properties due to the presence of hydroxyl groups, making it of interest in various applications, including pharmaceuticals and polymer chemistry. Its structural features also suggest potential for forming hydrogen bonds, which can affect its reactivity and interactions with other molecules.

Formula: C₁₄H₁₀O₆

InChI: InChI=1S/C14H10O6/c15-11-5-7(13(17)18)1-3-9(11)10-4-2-8(14(19)20)6-12(10)16/h1-6,15-16H,(H,17,18)(H,19,20)

InChI key: InChIKey=CVWDKBHAUIZWAY-UHFFFAOYSA-N

SMILES: OC1=C(C=CC(C(O)=O)=C1)C2=C(O)C=C(C(O)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4,4′-dicarboxylic acid, 2,2′-dihydroxy-
• 2,2′-Dihydroxy[1,1′-biphenyl]-4,4′-dicarboxylic acid
• 2,2′-Dihydroxybiphenyl-4,4′-dicarboxylic acid

[1,1′-Biphenyl]-4,4′-dicarboxylic acid, 2,2′-dihydroxy-

CAS: 41738-72-1

Formula: C₁₄H₁₀O₆

Purity: 97%

Color and Shape: Solid

Molecular weight: 274.2256

Ref: IN-DA01PP9E

2,2'-Dihydroxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid

CAS: 41738-72-1

2,2'-Dihydroxy-[1,1'-biphenyl]-4,4'-dicarboxylic acid

Purity: 97%

Molecular weight: 274.23g/mol

Ref: 54-OR1057083

2,2′-Dihydroxy-[1,1′-biphenyl]-4,4′-dicarboxylic acid

CAS: 41738-72-1

Purity: 98%

Molecular weight: 274.2279968

Ref: 10-F761593