CymitQuimica logo

CAS 41740-15-2

:

6-amino-1,3-diethylpyrimidine-2,4(1H,3H)-dione

Description:
6-Amino-1,3-diethylpyrimidine-2,4(1H,3H)-dione, with the CAS number 41740-15-2, is a heterocyclic organic compound characterized by a pyrimidine ring substituted with amino and ethyl groups. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential biological activity. The amino group enhances its ability to participate in hydrogen bonding, making it soluble in polar solvents. The ethyl substituents provide lipophilicity, which can influence its pharmacokinetic properties. This compound may exhibit various biological activities, including potential use in medicinal chemistry as a scaffold for drug development. Its structural features suggest that it could interact with biological targets, making it of interest in research related to pharmaceuticals. Additionally, the presence of multiple functional groups allows for further derivatization, which can lead to the synthesis of analogs with improved efficacy or selectivity. Overall, 6-amino-1,3-diethylpyrimidine-2,4(1H,3H)-dione is a versatile compound with potential applications in various fields, including medicinal chemistry and biochemistry.
Formula:C8H13N3O2
InChI:InChI=1/C8H13N3O2/c1-3-10-6(9)5-7(12)11(4-2)8(10)13/h5H,3-4,9H2,1-2H3
SMILES:CCn1c(cc(=O)n(CC)c1=O)N
Synonyms:
  • 2,4(1H,3H)-pyrimidinedione, 6-amino-1,3-diethyl-
  • Uracil, 6-amino-1,3-diethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.