CAS 41743-57-1

17-(β-D-Glucopyranosyloxy)-16-hydroxykauran-3-one

Description:

17-(β-D-Glucopyranosyloxy)-16-hydroxykauran-3-one, with the CAS number 41743-57-1, is a naturally occurring compound classified as a kaurene-type diterpenoid. This substance is characterized by its complex structure, which includes a glucopyranosyl moiety, contributing to its solubility and biological activity. The presence of hydroxyl groups enhances its reactivity and potential interactions with biological systems. It is primarily derived from various plant sources, particularly those known for their medicinal properties. The compound exhibits a range of biological activities, including anti-inflammatory and antioxidant effects, making it of interest in pharmacological research. Its structural features allow for potential interactions with enzymes and receptors, which may lead to therapeutic applications. Additionally, the glucopyranosyl group may influence its bioavailability and metabolism. Overall, 17-(β-D-Glucopyranosyloxy)-16-hydroxykauran-3-one represents a significant compound in the study of natural products and their potential health benefits.

Formula: C₂₆H₄₂O₈

InChI: InChI=1S/C26H42O8/c1-23(2)16-6-9-25-10-14(4-5-17(25)24(16,3)8-7-18(23)28)26(32,12-25)13-33-22-21(31)20(30)19(29)15(11-27)34-22/h14-17,19-22,27,29-32H,4-13H2,1-3H3/t14-,15-,16-,17+,19-,20+,21-,22-,24-,25+,26+/m1/s1

InChI key: InChIKey=XOCBTSXQUYSHOW-LGDJLJBTSA-N

SMILES: C[C@]12[C@]3([C@]4(C[C@]([C@](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)(O)C4)(CC3)[H])CC[C@@]1(C(C)(C)C(=O)CC2)[H])[H]

Synonyms:

• 17-(β-D-Glucopyranosyloxy)-16-hydroxykauran-3-one
• Sugereoside
• Kauran-3-one, 17-(β-D-glucopyranosyloxy)-16-hydroxy-

Sugeroside

CAS: 41743-57-1

Sugeroside is a natural product from Achillea clypeolata.

Formula: C₂₆H₄₂O₈

Purity: 98%

Color and Shape: Solid

Molecular weight: 482.61

Ref: TM-TN5076

Sugeroside

CAS: 41743-57-1

Sugeroside is a naturally occurring saponin, which is a type of glycoside found in various plants. Its primary source is derived from the plant Camellia japonica, commonly known as Japanese camellia. Sugeroside's mode of action involves its ability to interact with cell membranes, enhancing permeability and modulating biochemical pathways through its surfactant properties. This interaction often leads to varied biological activities, making sugeorside a molecule of interest in several scientific domains.

Formula: C₂₆H₄₂O₈

Purity: Min. 95%

Molecular weight: 482.6 g/mol

Ref: 3D-RBA74357