
CAS 41744-28-9
:Eupomatenoid 5
Description:
Eupomatenoid 5 is a naturally occurring chemical compound classified as a sesquiterpene, primarily derived from the Eupomatia genus of flowering plants. It is characterized by its complex bicyclic structure, which contributes to its unique chemical properties. Eupomatenoid 5 exhibits a range of biological activities, including potential anti-inflammatory and anticancer effects, making it of interest in pharmacological research. The compound is typically found in specific plant extracts and may possess a distinctive aroma, which can be attributed to its terpenoid nature. Its molecular interactions and mechanisms of action are subjects of ongoing studies, particularly in the context of natural product chemistry and drug development. As with many natural compounds, the extraction and purification processes can influence its availability and efficacy in various applications. Overall, Eupomatenoid 5 represents a fascinating area of study within the field of natural products and medicinal chemistry.
Formula:C19H18O3
InChI:InChI=1S/C19H18O3/c1-4-5-13-6-9-17-15(10-13)12(2)19(22-17)14-7-8-16(20)18(11-14)21-3/h4-11,20H,1-3H3/b5-4+
InChI key:InChIKey=HMGCTPMQYVGXSC-SNAWJCMRSA-N
SMILES:CC1=C(OC=2C1=CC(/C=C/C)=CC2)C3=CC(OC)=C(O)C=C3
Synonyms:- Phenol, 2-methoxy-4-[3-methyl-5-(1-propenyl)-2-benzofuranyl]-, (E)-
- Phenol, 2-methoxy-4-[3-methyl-5-(1E)-1-propenyl-2-benzofuranyl]-
- 2-Methoxy-4-[3-methyl-5-(1E)-1-propen-1-yl-2-benzofuranyl]phenol
- Phenol, 2-methoxy-4-[3-methyl-5-(1E)-1-propen-1-yl-2-benzofuranyl]-
- Eupomatenoid 5
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Eupomatenoid 5
CAS:Eupomatenoid 5 is a natural product that can be used as a reference standard. The CAS number of Eupomatenoid 5 is 41744-28-9.Formula:C19H18O3Color and Shape:SolidMolecular weight:294.35
