CAS 41744-59-6
:O-α-D-Galactopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-D-glucose
Description:
O-α-D-Galactopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-D-glucose, commonly referred to as a type of oligosaccharide, is a carbohydrate composed of multiple sugar units. This compound features a complex structure characterized by its glycosidic linkages, specifically an α-linkage between the first galactopyranose unit and the second galactopyranose unit, and a β-linkage connecting the second galactopyranose to the glucose unit. The presence of these specific linkages influences its solubility, sweetness, and digestibility. Oligosaccharides like this one are often found in various natural sources, including legumes and certain dairy products, and can play significant roles in human nutrition and gut health. They may serve as prebiotics, promoting the growth of beneficial gut bacteria. Additionally, this compound may exhibit various biological activities, including immunomodulatory effects. Its CAS number, 41744-59-6, allows for precise identification in chemical databases, facilitating research and application in fields such as food science and biochemistry.
Formula:C18H32O16
InChI:InChI=1S/C18H32O16/c19-1-5(23)9(25)15(6(24)2-20)33-18-14(30)16(11(27)8(4-22)32-18)34-17-13(29)12(28)10(26)7(3-21)31-17/h1,5-18,20-30H,2-4H2/t5-,6+,7+,8+,9+,10-,11-,12-,13+,14+,15+,16-,17+,18-/m0/s1
InChI key:InChIKey=KZZUYHVLNLDKLB-KXWZGOPVSA-N
SMILES:O([C@@H]1[C@@H](O)[C@H](O[C@@H]([C@@H]([C@H](C=O)O)O)[C@@H](CO)O)O[C@H](CO)[C@@H]1O)[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O
Synonyms:- <span class="text-smallcaps">D</smallcap>-Glucose, O-α-<smallcap>D</smallcap>-galactopyranosyl-(1→3)-O-β-<smallcap>D</span>-galactopyranosyl-(1→4)-
- Globoisotriaose
- Gly 070
- Isoglobotriaose
- Isoglobotriose
- O-α-<span class="text-smallcaps">D</smallcap>-Galactopyranosyl-(1→3)-O-β-<smallcap>D</smallcap>-galactopyranosyl-(1→4)-<smallcap>D</span>-glucose
- a-D-Galp-(1-4)-b-D-Galp-(1-4)-D-Glc
- α-<span class="text-smallcaps">D</smallcap>-Galp-(1-4)-β-<smallcap>D</smallcap>-Galp-(1-4)-<smallcap>D</span>-Glc
- D-Glucose, O-α-D-galactopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-
- O-α-D-Galactopyranosyl-(1→3)-O-β-D-galactopyranosyl-(1→4)-D-glucose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Gala1-3Galb1-4Glc
CAS:<p>Galacto-oligosaccharides (GOS) are a class of oligosaccharides that consist of galactose, galactose derivatives, and glucose. They are found in the human diet as a result of lactose breakdown by gut bacteria. GOS can bind to glycoconjugates in the human body, such as glycoproteins and glycolipids, and have been shown to be effective in preventing the growth of pathogens. Galacto-oligosaccharides are also synthetically produced, using a chromatographic method that separates them into individual sugars, where they can be used for research or diagnostic purposes. The biosynthesis of GOS is also known; it is an enzyme-catalyzed reaction involving calcium ions. This process is regulated by Ca2+ signaling, which leads to an increase in the production of GOS when there is a need for more immune cells or white blood cells.</p>Formula:C18H32O16Purity:Min. 90 Area-%Color and Shape:White PowderMolecular weight:504.44 g/mol
