CAS 41744-75-6
:16-methylheptadecan-1-ol
Description:
16-Methylheptadecan-1-ol, with the CAS number 41744-75-6, is a long-chain fatty alcohol characterized by its hydrophobic nature and a straight-chain structure. It consists of a 17-carbon backbone with a methyl group at the 16th position, which influences its physical and chemical properties. This compound is typically a waxy solid at room temperature and is insoluble in water, but soluble in organic solvents such as ethanol and ether. Its molecular structure contributes to its potential applications in various industries, including cosmetics, where it may serve as an emollient or thickening agent, and in the production of surfactants. Additionally, fatty alcohols like 16-methylheptadecan-1-ol are often used in the formulation of lubricants and plasticizers due to their ability to enhance the viscosity and stability of products. The presence of the hydroxyl (-OH) group also allows for potential reactivity in chemical synthesis, making it a versatile compound in organic chemistry.
Formula:C18H38O
InChI:InChI=1S/C18H38O/c1-18(2)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19/h18-19H,3-17H2,1-2H3
InChI key:InChIKey=WNWHHMBRJJOGFJ-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCO)CCCCC(C)C
Synonyms:- 1-Heptadecanol, 16-methyl-
- 16-Methyl-1-heptadecanol
- 16-Methylheptadecan-1-yl alcohol
- Isostearyl Alcohol EX
- 16-Methylheptadecan-1-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Isostearyl Alcohol EX
CAS:Controlled ProductFormula:C18H38OColor and Shape:NeatMolecular weight:270.494
