CAS 4175-66-0
:2,5-Dimethylthiazole
Description:
2,5-Dimethylthiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features two methyl groups attached to the thiazole ring at the 2 and 5 positions, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a strong, distinctive odor, often described as savory or meaty, which makes it useful in flavoring applications. 2,5-Dimethylthiazole is soluble in organic solvents and has limited solubility in water. It is known for its role in various biochemical processes and can be synthesized through different methods, including the reaction of appropriate thiazole precursors. Additionally, this compound is of interest in the field of agrochemicals and pharmaceuticals due to its potential biological activity. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2,5-Dimethylthiazole is a versatile compound with applications in food science and chemical research.
Formula:C5H7NS
InChI:InChI=1S/C5H7NS/c1-4-3-6-5(2)7-4/h3H,1-2H3
InChI key:InChIKey=WVUHHPQQQLBMOE-UHFFFAOYSA-N
SMILES:CC=1SC(C)=NC1
Synonyms:- 2,5-Dimethyl-1,3-Thiazole
- 2,5-Dimethylthiazole
- Thiazole, 2,5-dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,5-Dimethylthiazole
CAS:2,5-Dimethylthiazole is a heterocyclic compound containing a sulfur atom, widely used in biochemical experiments and drug synthesis research.Formula:C5H7NSPurity:99.87%Color and Shape:SolidMolecular weight:113.182,5-Dimethyl-1,3-thiazole
CAS:2,5-Dimethyl-1,3-thiazoleFormula:C5H7NSPurity:98%Color and Shape: pale yellow liquidMolecular weight:113.18g/mol2,5-Dimethylthiazole
CAS:<p>2,5-Dimethylthiazole is a chemical compound that has been synthesized and tested for its antifungal effects. It was found to have potent antifungal activity against T. rubrum at concentrations of 1-2 mg/mL. A study in humans showed that 2,5-Dimethylthiazole had no cytotoxicity or genotoxicity at doses up to 1000 mg/kg body weight. This drug also has an interaction with telomeres, which may be due to the inhibition of the enzyme DNA polymerase γ, preventing the synthesis of telomeric DNA repeats by inhibiting the addition of nucleotides to the 3' end of dsDNA.</p>Formula:C5H7NSPurity:Min. 95%Molecular weight:113.18 g/mol




