CAS 417721-69-8

4-chloro-3-iodopyridin-2-amine

Description:

4-Chloro-3-iodopyridin-2-amine is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with both a chlorine and an iodine atom, as well as an amino group. Its molecular structure features a six-membered aromatic ring containing five carbon atoms and one nitrogen atom, with the chlorine atom located at the 4-position and the iodine at the 3-position relative to the amino group at the 2-position. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The presence of halogens (chlorine and iodine) can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may have applications in medicinal chemistry and material science, owing to its unique structural features that can interact with biological targets or serve as intermediates in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.

Formula: C₅H₄ClIN₂

InChI: InChI=1/C5H4ClIN2/c6-3-1-2-9-5(8)4(3)7/h1-2H,(H2,8,9)

SMILES: c1c[nH]c(=N)c(c1Cl)I

Synonyms:

• 4-Chloro-3-Iodo-Pyridin-2-Ylamine

4-Chloro-3-iodopyridin-2-amine

CAS: 417721-69-8

Formula: C₅H₄ClIN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.4561

Ref: IN-DA0075D5

4-Chloro-3-iodopyridin-2-amine

CAS: 417721-69-8

4-Chloro-3-iodopyridin-2-amine

Formula: C₅H₄ClIN₂

Purity: 97%

Color and Shape: yellow solid

Molecular weight: 254.46g/mol

Ref: 54-OR303756

4-Chloro-3-iodopyridin-2-amine

CAS: 417721-69-8

Formula: C₅H₄ClIN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 254.46

Ref: 10-F091919

4-Chloro-3-iodopyridin-2-amine

CAS: 417721-69-8

Please enquire for more information about 4-Chloro-3-iodopyridin-2-amine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₅H₄ClIN₂

Purity: Min. 95%

Molecular weight: 254.46 g/mol

Ref: 3D-FC42195