CAS 41789-28-0

3-chloro-N-methylpropanamide

Description:

3-Chloro-N-methylpropanamide is an organic compound characterized by its amide functional group, which is derived from propanoic acid. The presence of a chlorine atom at the third carbon position of the propanamide chain contributes to its reactivity and potential applications in various chemical reactions. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents due to the amide group, which can engage in hydrogen bonding. The N-methyl substitution enhances its lipophilicity compared to unsubstituted propanamide, potentially influencing its biological activity and interactions. 3-Chloro-N-methylpropanamide may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its unique structural features. Safety data indicates that, like many chlorinated compounds, it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling protocols are essential to mitigate any potential hazards associated with this chemical.

Formula: C₄H₈ClNO

InChI: InChI=1/C4H8ClNO/c1-6-4(7)2-3-5/h2-3H2,1H3,(H,6,7)

SMILES: CN=C(CCCl)O

3-Chloro-N-methylpropanamide

CAS: 41789-28-0

Formula: C₄H₈ClNO

Purity: 98%

Color and Shape: Solid

Molecular weight: 121.5654

Ref: IN-DA00C8IW

3-Chloro-N-methylpropanamide

CAS: 41789-28-0

3-Chloro-N-methylpropanamide

Purity: 98%

Ref: 54-OR1040173

3-chloro-N-methylpropanamide

CAS: 41789-28-0

Formula: C₄H₈ClNO

Purity: 98%

Color and Shape: Solid, Light beige powder

Molecular weight: 121.56

Ref: 10-F310786