CAS 41790-73-2

2-(2-oxopyrrolidin-1-yl)benzoic acid

Description:

2-(2-Oxopyrrolidin-1-yl)benzoic acid, with the CAS number 41790-73-2, is a chemical compound characterized by its unique structure that combines a benzoic acid moiety with a pyrrolidinone ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in polar solvents due to the presence of the carboxylic acid group. The oxopyrrolidine portion contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit acidic properties due to the carboxylic acid functional group, which can participate in hydrogen bonding and influence its reactivity and interactions with biological targets. Additionally, the presence of the pyrrolidinone ring may impart specific conformational characteristics that affect its pharmacokinetics and pharmacodynamics. Overall, 2-(2-oxopyrrolidin-1-yl)benzoic acid is a compound of interest for further research, particularly in the fields of drug development and organic synthesis.

Formula: C₁₁H₁₁NO₃

InChI: InChI=1/C11H11NO3/c13-10-6-3-7-12(10)9-5-2-1-4-8(9)11(14)15/h1-2,4-5H,3,6-7H2,(H,14,15)

SMILES: c1ccc(c(c1)C(=O)O)N1CCCC1=O