CAS 41791-59-7

[(1-bromonaphthalen-2-yl)oxy]acetic acid

Description:

[(1-bromonaphthalen-2-yl)oxy]acetic acid, with the CAS number 41791-59-7, is an organic compound characterized by its unique structure that includes a naphthalene ring substituted with a bromine atom and an ether linkage to an acetic acid moiety. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, which can influence its solubility, reactivity, and potential applications. The presence of the bromine atom may enhance its electrophilic character, making it a useful intermediate in organic synthesis. Additionally, the naphthalene ring contributes to its hydrophobic characteristics, while the carboxylic acid group provides acidic properties. This compound may be utilized in various chemical reactions, including nucleophilic substitutions and coupling reactions, and could serve as a building block in the synthesis of more complex organic molecules. Its specific applications would depend on its reactivity and the functional groups present in the overall molecular structure.

Formula: C₁₂H₉BrO₃

InChI: InChI=1/C12H9BrO3/c13-12-9-4-2-1-3-8(9)5-6-10(12)16-7-11(14)15/h1-6H,7H2,(H,14,15)

SMILES: c1ccc2c(c1)ccc(c2Br)OCC(=O)O

Synonyms:

• (1-Bromo-naphthalen-2-yloxy)-acetic acid
• [(1-Bromo-2-naphthyl)oxy]acetic acid
• Acetic Acid, 2-[(1-Bromo-2-Naphthalenyl)Oxy]-

2-[(1-bromonaphthalen-2-yl)oxy]acetic acid

CAS: 41791-59-7

Formula: C₁₂H₉BrO₃

Molecular weight: 281.1021

Ref: IN-DA0075CY

2-[(1-Bromo-2-naphthyl)oxy]acetic acid

CAS: 41791-59-7

2-[(1-Bromo-2-naphthyl)oxy]acetic acid is a fluorescent probe that is used in fluorescence data assays. It has a low molecular weight of 216.3 and fluoresces when excited with UV light. 2-[(1-Bromo-2-naphthyl)oxy]acetic acid has been shown to inhibit the production of oxidase enzymes in vitro, which are found in many bacteria and fungi. 2-[(1-Bromo-2-naphthyl)oxy]acetic acid is also a substrate for the enzyme assembly, which catalyzes the formation of peptide bonds between amino acids. The probe can be used as a marker for protein synthesis and has been shown to have anti-diabetic effects in vivo.

Formula: C₁₂H₉BrO₃

Purity: Min. 95%

Molecular weight: 281.11 g/mol

Ref: 3D-RBA79159