
CAS 41806-40-0
:1-methyl-1H-imidazole-5-carboxylic acid
Description:
1-Methyl-1H-imidazole-5-carboxylic acid is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) at the 5-position of the imidazole ring and a methyl group (-CH3) at the 1-position. The presence of these functional groups contributes to its acidic properties and potential for hydrogen bonding, influencing its solubility in polar solvents. It is typically a white to off-white solid and is soluble in water due to the polar nature of the carboxylic acid group. This compound may be of interest in various fields, including pharmaceuticals and biochemistry, due to its potential biological activity and role as a building block in the synthesis of more complex molecules. Its unique structure allows for various chemical reactions, making it a versatile compound in organic synthesis.
Formula:C5H5N2O2
InChI:InChI=1/C5H6N2O2/c1-7-3-6-2-4(7)5(8)9/h2-3H,1H3,(H,8,9)/p-1
SMILES:Cn1cncc1C(=O)[O-]
Synonyms:- 1-Methylimidazole-5-carboxylic acid
- 1-methyl-1H-imidazole-5-carboxylate
- 1-Methyl-1H-Imidazol-5-Carbonic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-Methyl-1H-imidazole-5-carboxylic acid
CAS:Formula:C5H6N2O2Purity:97%Color and Shape:SolidMolecular weight:126.11331-Methyl-1H-imidazole-5-carboxylic acid
CAS:1-Methyl-1H-imidazole-5-carboxylic acidFormula:C5H6N2O2Purity:97%Color and Shape: white solidMolecular weight:126.11g/mol1-Methyl-1H-imidazole-5-carboxylic acid
CAS:Formula:C5H6N2O2Purity:98%Color and Shape:SolidMolecular weight:126.1151-Methyl-1H-imidazole-5-carboxylic acid
CAS:<p>1-Methyl-1H-imidazole-5-carboxylic acid is an amide that is used as a hardener in medicines. It can be synthesized by the reaction of ethyl formate with thionyl chloride and imidazoles. The yield of this product is high, and it can be produced in different stereoisomeric forms. 1-Methyl-1H-imidazole-5-carboxylic acid is used to produce other medicines, such as painkillers, tranquilizers, diuretics, and antibiotics. This product has been shown to have a number of health benefits, including reducing cholesterol levels and blood pressure.</p>Formula:C5H6N2O2Purity:Min. 95%Molecular weight:126.11 g/molRef: 3D-FM43801
Discontinued product



