CAS 41833-57-2

3-[(4-chlorophenyl)amino]propanenitrile

Description:

3-[(4-Chlorophenyl)amino]propanenitrile, with the CAS number 41833-57-2, is an organic compound characterized by its structure, which includes a propanenitrile backbone substituted with a 4-chlorophenyl amino group. This compound typically exhibits a white to off-white crystalline appearance. It is known for its potential applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various biologically active molecules. The presence of the nitrile functional group contributes to its reactivity, allowing for further chemical transformations. Additionally, the chlorophenyl moiety can influence the compound's lipophilicity and biological activity. As with many organic compounds, it is essential to handle this substance with care, considering its potential toxicity and the need for appropriate safety measures during handling and storage. Overall, 3-[(4-chlorophenyl)amino]propanenitrile is a compound of interest in chemical research and development due to its unique structural features and reactivity.

Formula: C₉H₉ClN₂

InChI: InChI=1/C9H9ClN2/c10-8-2-4-9(5-3-8)12-7-1-6-11/h2-5,12H,1,7H2

SMILES: C(C#N)CNc1ccc(cc1)Cl

Synonyms:

• Propanenitrile, 3-[(4-Chlorophenyl)Amino]-

3-[(4-Chlorophenyl)amino]propanenitrile

CAS: 41833-57-2

Versatile small molecule scaffold

Formula: C₉H₉ClN₂

Purity: Min. 95%

Molecular weight: 180.63 g/mol

Ref: 3D-RBA83357