CAS 41835-08-9
:1-(3-Cyanophenyl)-2-thiourea
Description:
1-(3-Cyanophenyl)-2-thiourea, with the CAS number 41835-08-9, is an organic compound characterized by the presence of a thiourea functional group and a cyanophenyl moiety. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The thiourea group imparts unique reactivity, allowing for participation in diverse chemical reactions, such as nucleophilic substitutions and cyclizations. The presence of the cyano group enhances its electronic properties, making it a candidate for further functionalization. Additionally, this compound may exhibit biological activity, which can be explored for medicinal chemistry applications. Its solubility and stability in different solvents can vary, influencing its practical use in synthesis and formulation. As with many thiourea derivatives, safety precautions should be observed due to potential toxicity and reactivity. Overall, 1-(3-Cyanophenyl)-2-thiourea represents a versatile structure in organic synthesis and material science.
Formula:C8H7N3S
InChI:InChI=1/C8H7N3S/c9-5-6-2-1-3-7(4-6)11-8(10)12/h1-4H,(H3,10,11,12)
SMILES:c1cc(cc(c1)NC(=N)S)C#N
Synonyms:- 1-(3-Cyanophenyl)Thiourea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.



