CAS 4184-79-6: 5,6-Dimethyl-1H-benzotriazole
Description:5,6-Dimethyl-1H-benzotriazole is an organic compound characterized by its triazole ring structure fused to a benzene ring, which contributes to its unique chemical properties. It is a colorless to pale yellow solid that is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. This compound is known for its ability to act as a UV stabilizer and antioxidant, making it valuable in various applications, including plastics, coatings, and polymers. Its molecular structure includes two methyl groups at the 5 and 6 positions of the benzotriazole ring, which influence its reactivity and stability. Additionally, 5,6-Dimethyl-1H-benzotriazole exhibits good thermal stability and can absorb UV radiation, providing protection against photodegradation. Safety data indicates that, while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed due to potential irritant properties. Overall, its chemical characteristics make it a useful additive in enhancing the longevity and performance of materials exposed to UV light.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-5-3-7-8(4-6(5)2)10-11-9-7/h3-4H,1-2H3,(H,9,10,11)
InChI key:InChIKey=MVPKIPGHRNIOPT-UHFFFAOYSA-N
SMILES:N1=NC=2C=C(C(=CC2N1)C)C
- Synonyms:
- 1H-Benzotriazole, 5,6-dimethyl-
- 5,6-Dimethyl-1,2,3-benzotriazole
- 5,6-Dimethyl-1H-benzotriazole
- 5,6-Dimethylbenzotriazole
- 5,6-Dimethylbenzotriazole monohydrate
- 5,6-dimethyl-2H-benzotriazole
- Benzotriazole, 5,6-dimethyl-
- NSC 62005
![5,6-Dimethyl-1H-benzo[d][1,2,3]triazole](https://static.cymitquimica.com/products/IN/thumb/DA003MA8.jpg)
![5,6-Dimethyl-1H-benzo[d][1,2,3]triazole](https://static.cymitquimica.com/products/10/thumb/F773707.jpg)
