CAS 41849-35-8
:Aconifine
Description:
Aconifine is an alkaloid derived from the plant Aconitum, commonly known as monkshood or wolfsbane. It is characterized by its complex bicyclic structure, which includes a nitrogen atom in its ring system, contributing to its classification as a tertiary amine. Aconifine exhibits a range of biological activities, including potential analgesic and anti-inflammatory properties, although it is primarily noted for its toxicity. The substance is known to interact with various ion channels and receptors in the nervous system, which can lead to significant physiological effects. Due to its toxic nature, aconifine poses risks of poisoning, and its use is heavily regulated in many regions. In terms of physical properties, aconifine is typically a crystalline solid, and its solubility can vary depending on the solvent used. As with many alkaloids, it is important to handle aconifine with caution, given its potential health hazards and the need for proper safety measures in any experimental or therapeutic context.
Formula:C34H47NO12
InChI:InChI=1S/C34H47NO12/c1-7-35-15-30(16-42-3)19(37)13-20(43-4)33-23(30)22(44-5)21(25(33)35)34(47-17(2)36)24-27(46-29(39)18-11-9-8-10-12-18)31(40,14-32(24,33)41)28(45-6)26(34)38/h8-12,19-28,37-38,40-41H,7,13-16H2,1-6H3/t19-,20+,21+,22+,23-,24+,25-,26+,27-,28+,30+,31-,32+,33-,34+/m1/s1
InChI key:InChIKey=GMSKTJVHWUUOMY-CGYMCTSDSA-N
SMILES:O[C@]12[C@]34[C@]5([C@](COC)(CN(CC)[C@@]3([C@]([C@@H]5OC)([C@]6(OC(C)=O)[C@]1([C@@H](OC(=O)C7=CC=CC=C7)[C@](O)(C2)[C@@H](OC)[C@@H]6O)[H])[H])[H])[C@H](O)C[C@@H]4OC)[H]
Synonyms:- Aconifine
- Nagarine
- Aconitane-3,8,10,13,14,15-hexol, 20-ethyl-1,6,16-trimethoxy-4-(methoxymethyl)-, 8-acetate 14-benzoate, (1α,3α,6α,14α,15α,16β)-
- 10-Hydroxyaconitine
- Nagarine (C34 alkaloid)
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Nagarine
CAS:Nagarine has toxic and analgesic effects.Formula:C34H47NO12Purity:98%Color and Shape:SolidMolecular weight:661.74510-Hydroxy aconitine
CAS:10-Hydroxy aconitine is an alkaloid compound, which is derived from the roots of Aconitum species, commonly known as monkshood. These plants are well-known for their production of various diterpenoid alkaloids, with 10-Hydroxy aconitine being one of the notable constituents. The mode of action of 10-Hydroxy aconitine primarily involves modulation of voltage-gated sodium channels, leading to altered nerve signal transmission. This activity can result in significant analgesic effects, although it must be approached with caution due to potential toxicological impacts.Formula:C34H47NO12Purity:Min. 95%Molecular weight:661.7 g/mol



