CAS 4185-00-6
:(5β,7α)-7-Hydroxy-3-oxocholan-24-oic acid
Description:
(5β,7α)-7-Hydroxy-3-oxocholan-24-oic acid, commonly known as a bile acid derivative, is a steroid compound characterized by its hydroxyl and keto functional groups. This substance features a steroid nucleus, which is a fused four-ring structure typical of steroids, and it possesses a hydroxyl group at the 7α position, contributing to its solubility and biological activity. The presence of the keto group at the 3 position and the carboxylic acid functionality at the 24 position further define its chemical properties and reactivity. This compound is involved in various biological processes, particularly in the metabolism of lipids and the regulation of cholesterol levels. Its structural characteristics allow it to interact with specific receptors in the body, influencing metabolic pathways. Additionally, it may exhibit potential therapeutic effects, making it of interest in pharmaceutical research. Overall, (5β,7α)-7-Hydroxy-3-oxocholan-24-oic acid is significant in both biochemistry and medicinal chemistry due to its role in lipid metabolism and potential health implications.
Formula:C24H38O4
InChI:InChI=1S/C24H38O4/c1-14(4-7-21(27)28)17-5-6-18-22-19(9-11-24(17,18)3)23(2)10-8-16(25)12-15(23)13-20(22)26/h14-15,17-20,22,26H,4-13H2,1-3H3,(H,27,28)/t14-,15+,17-,18+,19+,20-,22+,23+,24-/m1/s1
InChI key:InChIKey=KNVADAPHVNKTEP-CIGXQKLNSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)[C@](C[C@H]3O)(CC(=O)CC4)[H])(CC1)[H])[H])(CC[C@@]2([C@@H](CCC(O)=O)C)[H])[H]
Synonyms:- 5β-Cholanic acid, 7α-hydroxy-3-oxo-
- (5β,7α)-7-Hydroxy-3-oxocholan-24-oic acid
- 5β-Cholan-24-oic acid, 7α-hydroxy-3-oxo-
- Cholan-24-oic acid, 7-hydroxy-3-oxo-, (5β,7α)-
- 7α-Hydroxy-3-oxo-5β-cholanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
7α-hydroxy-3-oxo-5β-Cholan-24-oic Acid
CAS:Formula:C24H38O4Purity:98%Color and Shape:SolidMolecular weight:390.55613-keto-Chenodeoxycholic Acid
CAS:Formula:C24H38O4Purity:>99%Color and Shape:SolidMolecular weight:390.563-Oxo-7a-hydroxy-5b-cholanoic Acid
CAS:Controlled Product<p>Applications 3-Oxo-7a-hydroxy-5β-cholanoic Acid is a keto bile acid derivative.<br>References Bortolini, O. et al.: Tetra., 62, 4482 (2006); Bortolini, O. et al.: J. Org. Chem., 67, 5802 (2002);<br></p>Formula:C24H38O4Color and Shape:White To Light YellowMolecular weight:390.563-Oxo-7α-hydroxy-5β-cholanoic acid
CAS:Controlled Product<p>3-Oxo-7α-hydroxy-5β-cholanoic acid is a fatty acid that is an intermediate in the synthesis of bile acids. It is formed by the addition of hydroxyl groups to 7α, 12β-dihydroxycholesterol. The ethyl esters of 3-oxo-7α, 12β-dihydroxycholesterol are converted to 3-oxo-7α, 12β, 15β-, and 16β hydroxycholesterols by the action of bacteria such as Clostridium sp. or Propionibacterium sp. The formation of 3-oxo-7α, 12β, 15β-, and 16β hydroxycholesterols may be promoted by the presence of hydrochloric acid (HCl) or trifluoroacetic acid (TFA). 3OHDCA can be used for profiling human liver microsomes via HPLC analysis.</p>Formula:C24H38O4Purity:Min. 95%Molecular weight:390.6 g/mol3-Oxochenodeoxycholic acid
CAS:3-Oxochenodeoxycholic acid is an endogenous metabolite detectable in feces and may serve as a diagnostic marker for various diseases, including COVID-19.Formula:C24H38O4Color and Shape:SolidMolecular weight:390.556






