CAS 41855-35-0: 1-(2,3,5,6,8,9,11,12,14,15-decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecin-18-yl)ethanone
Description:1-(2,3,5,6,8,9,11,12,14,15-decahydro-1,4,7,10,13,16-benzohexaoxacyclooctadecin-18-yl)ethanone, with CAS number 41855-35-0, is a complex organic compound characterized by its unique structure that includes a benzohexaoxacyclooctadecane framework. This compound features multiple ether linkages, which contribute to its stability and solubility in various solvents. The presence of the ethanone functional group indicates that it has ketone characteristics, which may influence its reactivity and interactions with other chemical species. The intricate cyclic structure suggests potential applications in materials science, particularly in the development of polymers or as a precursor in organic synthesis. Additionally, the compound's molecular complexity may impart interesting physical properties, such as melting and boiling points, which are typically influenced by the degree of hydrogen bonding and molecular weight. Overall, this substance represents a fascinating area of study within organic chemistry, particularly in the context of synthetic methodologies and potential applications in various fields.
Formula:C18H26O7
InChI:InChI=1/C18H26O7/c1-15(19)16-2-3-17-18(14-16)25-13-11-23-9-7-21-5-4-20-6-8-22-10-12-24-17/h2-3,14H,4-13H2,1H3
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4'-Acetylbenzo-18-crown 6-Ether REF: 3B-A1604CAS: 41855-35-0 | >97.0%(GC) | 640.00 € | Thu 10 Apr 25 |
![]() | 4-ACETYLBENZO-18-CROWN 6-ETHER REF: IN-DA003KMTCAS: 41855-35-0 | 97% | To inquire | Thu 17 Apr 25 |
![]() | 4'-Acetylbenzo-18-crown 6-ether REF: 54-OR72896CAS: 41855-35-0 | - - - | To inquire | Mon 21 Apr 25 |
![]() | 4'-Acetylbenzo-18-crown 6-Ether REF: 3D-FA62067CAS: 41855-35-0 | Min. 95% | - - - | Discontinued product |

4'-Acetylbenzo-18-crown 6-Ether
Ref: 3B-A1604
1g | 640.00 € |

4-ACETYLBENZO-18-CROWN 6-ETHER
Ref: IN-DA003KMT
1g | 543.00 € | ||
200mg | 188.00 € |

4'-Acetylbenzo-18-crown 6-Ether
Ref: 3D-FA62067
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |