CAS 41859-54-5

N-Benzoyltyramine

Description:

N-Benzoyltyramine is an organic compound characterized by its structure, which includes a benzoyl group attached to the amino acid derivative tyramine. It typically appears as a white to off-white solid and is soluble in organic solvents. The compound exhibits properties associated with both amines and ketones due to the presence of the benzoyl moiety. N-Benzoyltyramine is of interest in various fields, including medicinal chemistry, where it may exhibit biological activity, potentially influencing neurotransmitter systems due to its structural similarity to other biologically active compounds. Its synthesis generally involves the acylation of tyramine with benzoyl chloride or a similar reagent. As with many organic compounds, safety precautions should be observed when handling N-Benzoyltyramine, as it may pose health risks if ingested or inhaled. Additionally, its stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, N-Benzoyltyramine serves as a valuable compound for research and potential therapeutic applications.

Formula: C₁₅H₁₅NO₂

InChI: InChI=1S/C15H15NO2/c17-14-8-6-12(7-9-14)10-11-16-15(18)13-4-2-1-3-5-13/h1-9,17H,10-11H2,(H,16,18)

InChI key: InChIKey=MUCNBPCTSRYLCB-UHFFFAOYSA-N

SMILES: C(NCCC1=CC=C(O)C=C1)(=O)C2=CC=CC=C2

Synonyms:

• Benzamide, N-(p-hydroxyphenethyl)-
• Benzamide, N-[2-(4-hydroxyphenyl)ethyl]-
• N-[2-(4-Hydroxyphenyl)ethyl]benzamide
• N-Benzoyltyramine
• 4-[2-(Benzoylamino)ethyl]phenol

N-benzoyltyramine

CAS: 41859-54-5

N-benzoyltyramine is a natural product that can be used as a reference standard. The CAS number of N-benzoyltyramine is 41859-54-5.

Formula: C₁₅H₁₅NO₂

Color and Shape: Solid

Molecular weight: 241.3

Ref: TM-TN7408