CAS 41860-63-3

1,2,4-Trifluoro-5-iodobenzene

Description:

1,2,4-Trifluoro-5-iodobenzene is an aromatic halogenated compound characterized by the presence of three fluorine atoms and one iodine atom attached to a benzene ring. The molecular structure features a benzene core with the trifluoro group located at the 1, 2, and 4 positions and the iodine substituent at the 5 position. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It exhibits significant polarity due to the electronegative halogen atoms, which can influence its reactivity and solubility in various solvents. The presence of multiple halogens makes it a potential candidate for applications in organic synthesis, pharmaceuticals, and materials science. Additionally, its unique electronic properties may allow for specific interactions in chemical reactions, making it valuable in the development of new chemical entities. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health and environmental risks.

Formula: C₆H₂F₃I

InChI: InChI=1/C6H2F3I/c7-3-1-5(9)6(10)2-4(3)8/h1-2H

SMILES: c1c(c(cc(c1F)I)F)F

Synonyms:

• Benzene, 1,2,4-trifluoro-5-iodo-
• 2,4,5-Trifluoroiodobenzene
• 1-Iodo-2,4,5-Trifluorobenzene

1,3,5-Trifluoro-2-iodobenzene

CAS: 41860-63-3

Formula: C₆H₂F₃I

Purity: 98%

Color and Shape: Liquid

Molecular weight: 257.9798

Ref: IN-DA0074ZS

2,4,6-Trifluoroiodobenzene

CAS: 41860-63-3

2,4,6-Trifluoroiodobenzene

Purity: 98%

Color and Shape: Solid

Molecular weight: 257.98g/mol

Ref: 54-PC50367

2,4,6-Trifluoroiodobenzene

CAS: 41860-63-3

Formula: C₆H₂F₃I

Purity: 98%

Color and Shape: Solid

Molecular weight: 257.982

Ref: 10-F021384