CAS 41867-20-3
:Ethyl (2E)-3-amino-2-butenoate
Description:
Ethyl (2E)-3-amino-2-butenoate, with the CAS number 41867-20-3, is an organic compound characterized by its amino acid-like structure. It features an ethyl ester functional group, which contributes to its solubility in organic solvents. The compound contains a double bond in the butenoate chain, indicating its unsaturation, and an amino group that can participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Ethyl (2E)-3-amino-2-butenoate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is often used in organic synthesis, particularly in the preparation of more complex molecules, including pharmaceuticals and agrochemicals. The presence of both the amino and ester functionalities allows for diverse reactivity, making it a valuable intermediate in synthetic chemistry. Additionally, its structural features suggest potential biological activity, which may warrant further investigation in medicinal chemistry contexts.
Formula:C6H11NO2
InChI:InChI=1S/C6H11NO2/c1-3-9-6(8)4-5(2)7/h4H,3,7H2,1-2H3/b5-4+
InChI key:InChIKey=YPMPTULBFPFSEQ-SNAWJCMRSA-N
SMILES:C(\C(OCC)=O)=C(\C)/N
Synonyms:- 2-Butenoic acid, 3-amino-, ethyl ester, (2E)-
- 2-Butenoic acid, 3-amino-, ethyl ester, (E)-
- Ethyl (E)-3-aminobut-2-enoate
- Ethyl (E)-3-aminocrotonate
- Ethyl (2E)-3-amino-2-butenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
