CAS 418780-23-1
:2-(4-chlorophenyl)-N-(2-nitrobenzyl)ethanamine
Description:
2-(4-chlorophenyl)-N-(2-nitrobenzyl)ethanamine, identified by its CAS number 418780-23-1, is an organic compound characterized by its complex structure, which includes an ethanamine backbone substituted with a 4-chlorophenyl group and a 2-nitrobenzyl moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the nitro group introduces significant polarity and can affect the compound's reactivity, making it potentially useful in various chemical reactions or as a precursor in synthetic pathways. Additionally, the chlorophenyl group may impart specific electronic properties, influencing the compound's interaction with biological systems or its application in pharmaceuticals. Overall, the unique combination of functional groups in this compound suggests potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies on its biological activity and safety profile would be necessary to fully understand its applications.
Formula:C15H15ClN2O2
InChI:InChI=1/C15H15ClN2O2/c16-14-7-5-12(6-8-14)9-10-17-11-13-3-1-2-4-15(13)18(19)20/h1-8,17H,9-11H2
SMILES:c1ccc(c(c1)CNCCc1ccc(cc1)Cl)N(=O)=O
Synonyms:- benzeneethanamine, 4-chloro-N-[(2-nitrophenyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.