CAS 418788-90-6
:3-(2,3-dichlorophenoxy)-N-(2-hydroxyethyl)propan-1-aminium
Description:
3-(2,3-Dichlorophenoxy)-N-(2-hydroxyethyl)propan-1-aminium, with the CAS number 418788-90-6, is a quaternary ammonium compound characterized by its cationic nature due to the presence of a positively charged nitrogen atom. This compound features a propan-1-aminium backbone, which is substituted with a 2,3-dichlorophenoxy group and a hydroxyethyl group, contributing to its unique chemical properties. The dichlorophenoxy moiety enhances its hydrophobic characteristics, while the hydroxyethyl group increases its solubility in polar solvents. This compound is likely to exhibit antimicrobial properties, making it of interest in various applications, including disinfectants and surfactants. Its quaternary structure may also impart stability and effectiveness in biological systems. Additionally, the presence of chlorine atoms can influence its reactivity and interaction with biological membranes. Overall, this compound's structural features suggest potential utility in both industrial and pharmaceutical contexts, although specific applications would depend on further research and testing.
Formula:C11H16Cl2NO2
InChI:InChI=1/C11H15Cl2NO2/c12-9-3-1-4-10(11(9)13)16-8-2-5-14-6-7-15/h1,3-4,14-15H,2,5-8H2/p+1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(3-(2,3-Dichlorophenoxy)propylamino)ethanol hydrochloride
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C11H15Cl2NO2•HClColor and Shape:PowderMolecular weight:300.612,3-DCPE
CAS:Induces p21, S-phase arrest in cancer cells through ERK pathways. IC50: 0.89 μM (LoVo cells), 12.6 μM (fibroblasts).Formula:C11H15Cl2NO2Purity:98%Color and Shape:SolidMolecular weight:264.15

