CymitQuimica logo

CAS 41882-44-4

:

2,2-dimethylpropanediamide

Description:
2,2-Dimethylpropanediamide, with the CAS number 41882-44-4, is an organic compound characterized by its amide functional groups. It features a branched structure, which includes two methyl groups attached to the second carbon of a propane backbone, along with two amine groups (-NH2) at the terminal ends. This compound is typically a colorless to pale yellow solid at room temperature and is soluble in polar solvents due to the presence of the amide groups, which can engage in hydrogen bonding. Its molecular structure contributes to its relatively high melting and boiling points compared to similar compounds without branching. 2,2-Dimethylpropanediamide may be utilized in various applications, including as a building block in organic synthesis and potentially in the development of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H10N2O2
InChI:InChI=1/C5H10N2O2/c1-5(2,3(6)8)4(7)9/h1-2H3,(H2,6,8)(H2,7,9)
InChI key:NCYLMOVCPMNHEP-UHFFFAOYSA-N
SMILES:CC(C)(C(=N)O)C(=N)O
Found 4 products.