CAS 41893-78-1

3-amino-4-(diethylamino)benzenesulfonamide

Description:

3-Amino-4-(diethylamino)benzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features an amino group and a diethylamino group attached to a benzene ring, contributing to its potential biological activity. The presence of the sulfonamide moiety enhances its solubility in water, making it suitable for various applications in pharmaceuticals and biochemistry. The compound's structure allows for interactions with biological targets, which may include enzymes or receptors, potentially influencing metabolic pathways. Its CAS number, 41893-78-1, is a unique identifier that facilitates the tracking and study of this substance in scientific literature and regulatory databases. Overall, 3-amino-4-(diethylamino)benzenesulfonamide exemplifies the diverse functionalities of sulfonamides, which are widely researched for their therapeutic potential.

Formula: C₁₀H₁₇N₃O₂S

InChI: InChI=1/C10H17N3O2S/c1-3-13(4-2)10-6-5-8(7-9(10)11)16(12,14)15/h5-7H,3-4,11H2,1-2H3,(H2,12,14,15)

SMILES: CCN(CC)c1ccc(cc1N)S(=O)(=O)N

3-amino-4-(diethylamino)benzene-1-sulfonamide

CAS: 41893-78-1

Formula: C₁₀H₁₇N₃O₂S

Molecular weight: 243.3259

Ref: IN-DA0074AR

3-Amino-4-(diethylamino)benzene-1-sulfonamide

CAS: 41893-78-1

3-Amino-4-(diethylamino)benzene-1-sulfonamide

Purity: 95%

Molecular weight: 243.33g/mol

Ref: 54-OR84641

3-Amino-4-(diethylamino)benzene-1-sulfonamide

CAS: 41893-78-1

Purity: 97%

Molecular weight: 243.3300018

Ref: 10-F649877