CAS 41894-76-2

bicyclo[4.1.0]heptane-7-carboxylic acid

Description:

Bicyclo[4.1.0]heptane-7-carboxylic acid is a bicyclic organic compound characterized by its unique structure, which features a bicyclo[4.1.0] framework and a carboxylic acid functional group. This compound consists of a seven-membered ring system with two bridged carbon atoms, contributing to its rigidity and distinctive chemical properties. The presence of the carboxylic acid group (-COOH) imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and decarboxylation. Bicyclo[4.1.0]heptane-7-carboxylic acid may exhibit interesting reactivity due to the strain in its bicyclic structure, which can influence its stability and reactivity in synthetic applications. Additionally, its unique structure may lead to specific interactions in biological systems, making it of interest in medicinal chemistry and materials science. Overall, this compound's structural features and functional groups contribute to its potential utility in various chemical and industrial applications.

Formula: C₈H₁₂O₂

InChI: InChI=1/C8H12O2/c9-8(10)7-5-3-1-2-4-6(5)7/h5-7H,1-4H2,(H,9,10)

SMILES: C1CCC2C(C1)C2C(=O)O

Bicyclo[4.1.0]heptane-7-carboxylic acid

CAS: 41894-76-2

Formula: C₈H₁₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 140.1797

Ref: IN-DA00I85J

Bicyclo[4.1.0]heptane-7-carboxylic acid

CAS: 41894-76-2

Bicyclo[4.1.0]heptane-7-carboxylic acid

Purity: 95%

Molecular weight: 140.18g/mol

Ref: 54-OR84883

Bicyclo[4.1.0]heptane-7-carboxylic acid

CAS: 41894-76-2

Purity: 97%

Molecular weight: 140.1820068359375

Ref: 10-F617726

Bicyclo[4.1.0]heptane-7-carboxylic Acid

Controlled Product

CAS: 41894-76-2

Applications Bicyclo[4.1.0]Heptane-7-Carboxylic Acid (cas# 41894-76-2) is a useful reagent for the heteroatom-​directed C-​H borylation of cyclopropanes and cyclobutanes.
References Murakami, R., et al.: Chem. Eur. J., 20, 13127 (2014)

Formula: C₈H₁₂O₂

Color and Shape: Neat

Molecular weight: 140.17

Ref: TR-C986323