CymitQuimica logo

CAS 41910-64-9

:

4-Chloroindoline

Description:
4-Chloroindoline is an organic compound characterized by its indoline structure, which consists of a fused benzene and pyrrole ring, with a chlorine atom substituted at the fourth position of the indoline moiety. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and organic synthesis. The presence of the chlorine atom can influence its reactivity and solubility, making it a valuable intermediate in the synthesis of various chemical entities. 4-Chloroindoline may exhibit biological activity, which has garnered interest in medicinal chemistry for the development of new therapeutic agents. Its molecular properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. As with many halogenated compounds, safety precautions should be taken when handling 4-Chloroindoline due to potential toxicity and environmental concerns. Overall, this compound represents a significant interest in both academic research and industrial applications.
Formula:C8H8ClN
InChI:InChI=1S/C8H8ClN/c9-7-2-1-3-8-6(7)4-5-10-8/h1-3,10H,4-5H2
InChI key:InChIKey=BBHMZHDPVNXFMI-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC=C1)NCC2
Synonyms:
  • 1H-Indole, 4-chloro-2,3-dihydro-
  • 4-Chloro-2,3-dihydro-1H-indole
  • 4-Chloro-2,3-dihydro-indole
  • Indoline, 4-chloro-
  • 4-Chloroindoline
Found 5 products.