CAS 4192-31-8
:4-Oxo-4-(3-pyridyl)butyric acid
Description:
4-Oxo-4-(3-pyridyl)butyric acid, with the CAS number 4192-31-8, is an organic compound characterized by its pyridine ring and a butyric acid moiety. This substance features a ketone functional group (the 4-oxo group) and is known for its potential biological activity, particularly in medicinal chemistry. The presence of the pyridine ring contributes to its polar nature, which can influence its solubility and reactivity. Typically, compounds like this may exhibit properties such as being a weak acid due to the carboxylic acid group, and they may participate in hydrogen bonding due to the presence of both the carboxylic acid and the nitrogen atom in the pyridine ring. Its structural characteristics suggest potential applications in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. However, specific properties such as melting point, boiling point, and solubility can vary and should be referenced from reliable chemical databases or literature for precise information.
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c11-8(3-4-9(12)13)7-2-1-5-10-6-7/h1-2,5-6H,3-4H2,(H,12,13)
InChI key:InChIKey=JGSUNMCABQUBOY-UHFFFAOYSA-N
SMILES:C(CCC(O)=O)(=O)C=1C=CC=NC1
Synonyms:- 3-Pyridinebutyric acid, γ-oxo-
- γ-Oxo-3-pyridinebutanoic acid
- γ-3-Pyridyl-γ-oxobutyric acid
- 3-Pyridinebutanoic acid, γ-oxo-
- γ-Oxo-3-pyridinebutyric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(PYRID-3-YL)-4-OXO-BUTYRIC ACID HYDROCHLORIDE
CAS:Formula:C9H9NO3Purity:95%Color and Shape:SolidMolecular weight:179.17274-Oxo-4-(pyridin-3-yl)butanoic acid
CAS:4-Oxo-4-(pyridin-3-yl)butanoic acidPurity:95%Molecular weight:179.18g/molγ-Oxo-3-pyridinebutyric Acid
CAS:Controlled ProductApplications γ-Oxo-3-pyridinebutyric Acid (cas# 4192-31-8) is a compound useful in organic synthesis.
Formula:C9H9NO3Color and Shape:NeatMolecular weight:179.174-Oxo-4-(3-pyridyl)butyric acid
CAS:Formula:C9H9NO3Purity:≥95%Color and Shape:SolidMolecular weight:179.175γ-Oxo-3-pyridinebutyric acid
CAS:Gamma-oxo-3-pyridinebutyric acid (GOBA) is a non-protein amino acid that has been shown to be involved in the development of cancer. GOBA was found to be present in urine samples from patients with liver cancer and breast cancer, as well as in healthy individuals. GOBA is also present in rat liver microsomes and human liver, where it is converted into gamma-aminobutyric acid (GABA). This conversion may be due to GOBA's hydroxy group that can be oxidized by cytochrome P450 enzymes. The biological activity of GOBA appears to depend on its carboxyl group, which can form a complex with molybdenum. This complex inhibits the activity of the protein polymerase chain reaction, leading to a decrease in transcriptional regulation. In animal experiments, GOBA has been shown to inhibit tumor growth and induce cell cycle arrest by inhibiting the expression of cyclin D1 at theFormula:C9H9NO3Purity:Min. 95%Color and Shape:PowderMolecular weight:179.17 g/mol





