CAS 41926-06-1

1-methyl-1H-indazol-7-amine

Description:

1-Methyl-1H-indazol-7-amine is a chemical compound characterized by its indazole core, which is a five-membered aromatic ring structure containing two nitrogen atoms. This compound features a methyl group attached to the nitrogen at position one and an amino group at position seven of the indazole ring. It is typically a solid at room temperature and may exhibit properties such as solubility in polar organic solvents. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. 1-Methyl-1H-indazol-7-amine may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its structure allows for various modifications, which can enhance its pharmacological properties. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including electrophilic substitutions and coupling reactions, making it a versatile compound in synthetic organic chemistry.

Formula: C₈H₉N₃

InChI: InChI=1/C8H9N3/c1-11-8-6(5-10-11)3-2-4-7(8)9/h2-5H,9H2,1H3

SMILES: Cn1c2c(cccc2N)cn1

Synonyms:

• 1H-Indazol-7-amine, 1-methyl-
• 1-Methyl-1H-indazol-7-ylamine

1-Methyl-1H-indazol-7-ylamine

CAS: 41926-06-1

Formula: C₈H₉N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 147.1772

Ref: IN-DA00C7KS

7-Amino-1-methyl-1H-indazole

CAS: 41926-06-1

7-Amino-1-methyl-1H-indazole

Formula: C₈H₉N₃

Purity: ≥95%

Color and Shape: very dark brown crystalline power powder

Molecular weight: 147.18g/mol

Ref: 54-OR59931

7-Amino-1-methylindazole

CAS: 41926-06-1

Formula: C₈H₉N₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 147.181

Ref: 10-F093232