CymitQuimica logo

CAS 41927-17-7

:

1,2-Benzenediamine, 4-(phenylmethoxy)-

Description:
1,2-Benzenediamine, 4-(phenylmethoxy)-, also known by its CAS number 41927-17-7, is an organic compound characterized by the presence of two amino groups (-NH2) attached to a benzene ring, along with a phenylmethoxy group (-O-phenyl) at the para position relative to one of the amino groups. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic structure. The presence of amino groups makes it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its phenylmethoxy substituent can influence its reactivity and solubility, making it useful in applications such as dye synthesis, pharmaceuticals, and as an intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential applications in medicinal chemistry. Safety data should be consulted, as compounds with amino groups can be hazardous and may require appropriate handling and storage precautions.
Formula:C13H14N2O
InChI:InChI=1S/C13H14N2O/c14-12-7-6-11(8-13(12)15)16-9-10-4-2-1-3-5-10/h1-8H,9,14-15H2
InChI key:UQVGKXPXBIVFMV-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC2=CC(=C(C=C2)N)N
Found 5 products.