CAS 41927-89-3
:N-[(4-{[(2-amino-5-formyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid - calcium (1:1) pentahydrate
Description:
N-[(4-{[(2-amino-5-formyl-4-oxo-1,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)carbonyl]-L-glutamic acid - calcium (1:1) pentahydrate, with CAS number 41927-89-3, is a complex organic compound that features a pteridine derivative linked to an amino acid, specifically L-glutamic acid. This substance is characterized by its intricate molecular structure, which includes multiple functional groups such as amines, carbonyls, and carboxylic acids, contributing to its potential biological activity. The presence of calcium in a 1:1 molar ratio suggests a role in stabilizing the compound or enhancing its solubility. As a pentahydrate, it contains five water molecules, which can influence its physical properties, such as solubility and stability under various conditions. This compound may exhibit pharmacological properties, potentially acting as a therapeutic agent, although specific biological activities would require further investigation. Its complex structure and hydration state make it a subject of interest in medicinal chemistry and drug formulation.
Formula:C20H33CaN7O12
InChI:InChI=1/C20H23N7O7.Ca.5H2O/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30;;;;;;/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32);;5*1H2/t12?,13-;;;;;;/m0....../s1
SMILES:c1cc(ccc1C(=O)N[C@@H](CCC(=O)O)C(=O)O)NCC1CNc2c(c(nc(=N)[nH]2)O)N1C=O.[Ca].O.O.O.O.O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Folinate calcium pentahydrate (old ref. = c0607)
CAS:<p>Folinate calcium pentahydrate is an analog of folic acid that has been used as an anticancer agent in the treatment of various types of tumors and cancers. This drug works by inhibiting the activity of dihydrofolate reductase, which is involved in the synthesis of DNA and RNA. Folinate calcium pentahydrate has been shown to be effective against caffeine-induced apoptosis in human cancer cells and can also inhibit the activity of protein kinase inhibitors. Additionally, this drug has been found to have a synergistic effect with oxytocin in inhibiting tumor growth in Chinese hamsters. Folinate calcium pentahydrate may be excreted unchanged or as metabolites in urine, making it a suitable option for patients with renal impairment.</p>Formula:C20H31CaN7O12Purity:Min. 95%Molecular weight:601.6 g/mol
