
CAS 41931-86-6
:Decanoic acid, 3-[4-[10,11-dihydro-8-(methylthio)dibenzo[b,f]thiepin-10-yl]-1-piperazinyl]propyl ester
Description:
Decanoic acid, 3-[4-[10,11-dihydro-8-(methylthio)dibenzo[b,f]thiepin-10-yl]-1-piperazinyl]propyl ester, identified by CAS number 41931-86-6, is a chemical compound characterized by its complex structure, which includes a decanoic acid moiety linked to a piperazine derivative. This compound features a dibenzo[b,f]thiepin core, which contributes to its potential pharmacological properties. The presence of the methylthio group suggests possible interactions with biological systems, enhancing its lipophilicity and influencing its solubility in organic solvents. The ester functional group indicates that it may undergo hydrolysis in biological environments, potentially releasing decanoic acid and the piperazine derivative. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the precise molecular interactions and the environment in which it is studied. Overall, this compound represents a unique combination of structural features that may confer interesting properties for research and application.
Formula:C32H46N2O2S2
InChI:InChI=1S/C32H46N2O2S2/c1-3-4-5-6-7-8-9-15-32(35)36-23-12-18-33-19-21-34(22-20-33)29-24-26-13-10-11-14-30(26)38-31-17-16-27(37-2)25-28(29)31/h10-11,13-14,16-17,25,29H,3-9,12,15,18-24H2,1-2H3
InChI key:InChIKey=SUVSVBSQNAUQJU-UHFFFAOYSA-N
SMILES:S(C)C=1C=C2C(CC=3C(SC2=CC1)=CC=CC3)N4CCN(CCCOC(CCCCCCCCC)=O)CC4
Synonyms:- Oxyprothepin decanoate
- Decanoic acid, 3-[4-[10,11-dihydro-8-(methylthio)dibenzo[b,f]thiepin-10-yl]-1-piperazinyl]propyl ester
- Dibenzo[b,f]thiepin, decanoic acid deriv.
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Oxyprothepine decanoate
CAS:Oxyprothepine decanoate is a biochemical.Formula:C32H46N2O2S2Color and Shape:SolidMolecular weight:554.85
