CAS 41937-02-4
:1-(4-amino-3,5-dibromophenyl)-2-(tert-butylamino)ethanol
Description:
1-(4-amino-3,5-dibromophenyl)-2-(tert-butylamino)ethanol, with CAS number 41937-02-4, is a chemical compound characterized by its complex structure, which includes an amino group, a dibromophenyl moiety, and a tert-butylamino group attached to an ethanol backbone. This compound is typically classified as an organic amine and may exhibit properties such as solubility in polar solvents due to the presence of the hydroxyl group in the ethanol portion. The dibromophenyl group contributes to its potential reactivity and biological activity, making it of interest in medicinal chemistry and drug development. The presence of multiple bromine atoms can enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the tert-butylamino group may impart steric hindrance, affecting the compound's conformation and reactivity. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents. However, specific properties such as melting point, boiling point, and toxicity would require empirical data for comprehensive understanding.
Formula:C12H18Br2N2O
InChI:InChI=1/C12H18Br2N2O/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7/h4-5,10,16-17H,6,15H2,1-3H3
SMILES:CC(C)(C)NCC(c1cc(c(c(c1)Br)N)Br)O
Synonyms:- Benzenemethanol, 4-amino-3,5-dibromo-alpha-(((1,1-dimethylethyl)amino)methyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Bromobuterol
CAS:<p>Bromobuterol is a physiological effector that belongs to the class of trifluoroacetic acid derivatives. Bromobuterol has been used in analytical chemistry to measure fatty acids in animal tissues and as an analytical method for detection of clenbuterol in urine samples. Bromobuterol has also been shown to be a potent fluorescence probe with high sensitivity, which can be used for detection of ethylene diamine and hydroxyl groups.</p>Formula:C12H18Br2N2OPurity:Min. 95%Molecular weight:366.09 g/mol
