CAS 41939-61-1
:N1-Methyl-4-nitro-o-phenyldiamin
Description:
N1-Methyl-4-nitro-o-phenyldiamine, with the CAS number 41939-61-1, is an organic compound characterized by its aromatic structure and the presence of both amino and nitro functional groups. This compound typically appears as a solid and is known for its potential use in dye manufacturing and as an intermediate in organic synthesis. The presence of the nitro group contributes to its reactivity, making it a candidate for various chemical transformations. Additionally, the methyl group attached to the nitrogen atom influences its solubility and overall chemical behavior. Safety considerations are important when handling this compound, as nitroanilines can be hazardous, potentially posing risks such as toxicity and environmental impact. Proper storage and handling protocols should be followed to mitigate any risks associated with exposure. Overall, N1-Methyl-4-nitro-o-phenyldiamine is a significant compound in the field of organic chemistry, particularly in applications related to dyes and pigments.
Formula:C7H9N3O2
InChI:InChI=1/C7H9N3O2/c1-9-7-3-2-5(10(11)12)4-6(7)8/h2-4,9H,8H2,1H3
SMILES:CNc1ccc(cc1N)N(=O)=O
Synonyms:- 1,2-Benzenediamine, N~1~-methyl-4-nitro-
- N~1~-Methyl-4-nitrobenzene-1,2-diamine
- N1-Methyl-4-nitrobenzene-1,2-diamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N1-Methyl-4-nitro-1,2-phenylenediamine
CAS:Formula:C7H9N3O2Purity:>98.0%(GC)Color and Shape:Red to Dark red to Brown powder to crystalMolecular weight:167.17N1-Methyl-4-nitro-o-phenyldiamin
CAS:Formula:C7H9N3O2Purity:98%Color and Shape:SolidMolecular weight:167.1653Ref: IN-DA00C6U1
1g25.00€5g31.00€10g50.00€1kgTo inquire25g73.00€50g114.00€100g159.00€250g302.00€500g530.00€N1-Methyl-4-nitrobenzene-1,2-diamine
CAS:N1-Methyl-4-nitrobenzene-1,2-diaminePurity:98%Color and Shape:Red PowderMolecular weight:167.16526g/molN'-Methyl-4-nitrophenylene-1,2-diamine
CAS:N'-Methyl-4-nitrophenylene-1,2-diamine is a chemical compound that has been used in the synthesis of some new quaternary ammonium salts. It has been shown to be resistant to nitration and oxidation by atmospheric oxygen and nitric acid. N'-Methyl-4-nitrophenylene-1,2-diamine has also been used in the synthesis of a copper complex that exhibits strong absorption at short wavelengths. The azomethine group is responsible for the quinoxaline spectra and for the absorption band at about 260 nm. The yields of this compound are low, but it can be obtained from other more easily available compounds.Formula:C7H9N3O2Purity:Min. 97 Area-%Color and Shape:Red PowderMolecular weight:167.17 g/molN1-Methyl-4-nitrobenzene-1,2-diamine
CAS:Formula:C7H9N3O2Purity:96%Color and Shape:SolidMolecular weight:167.168N'-Methyl-4-nitrophenylene-1,2-diamine
CAS:Controlled ProductFormula:C7H9N3O2Color and Shape:NeatMolecular weight:167.17







