CAS 41951-76-2

2-(hydroxymethyl)-4-methoxyphenol

Description:

2-(Hydroxymethyl)-4-methoxyphenol, also known as a derivative of phenol, is characterized by the presence of a hydroxymethyl group and a methoxy group attached to a benzene ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, with limited solubility in water. The hydroxymethyl group contributes to its reactivity, allowing it to participate in various chemical reactions, such as etherification and esterification. The methoxy group enhances its lipophilicity and can influence its biological activity. This compound is often studied for its potential applications in pharmaceuticals, cosmetics, and as an antioxidant due to its phenolic structure, which can scavenge free radicals. Additionally, it may exhibit antimicrobial properties, making it of interest in various industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₈H₁₀O₃

InChI: InChI=1/C8H10O3/c1-11-7-2-3-8(10)6(4-7)5-9/h2-4,9-10H,5H2,1H3

SMILES: COc1ccc(c(c1)CO)O

Synonyms:

• Benzenemethanol, 2-Hydroxy-5-Methoxy-
• 2-(Hydroxymethyl)-4-methoxyphenol

2-Hydroxy-5-methoxybenzyl alcohol

CAS: 41951-76-2

2-Hydroxy-5-methoxybenzyl alcohol (2HMB) is a methide that is used as an inductor in the synthesis of Taxol. 2HMB has been shown to induce apoptosis in MCF-7 cells and to promote the hydration of oxacycles. It can also be used in cancer research as a kinetic probe for the hydration of oxacycles. 2HMB activates MCF-7 cells and induces apoptosis, which may be due to its nucleophilic properties.

Formula: C₈H₁₀O₃

Purity: Min. 95%

Molecular weight: 154.16 g/mol

Ref: 3D-FH67190