CAS 419534-31-9
:(2E,4E,6Z,8E)-9-(4-methoxy-2,3,6-trimethyl-phenyl)-3,7-dimethyl-nona-2,4,6,8-tetraenoic acid
Description:
The chemical substance known as (2E,4E,6Z,8E)-9-(4-methoxy-2,3,6-trimethyl-phenyl)-3,7-dimethyl-nona-2,4,6,8-tetraenoic acid, with the CAS number 419534-31-9, is a complex organic compound characterized by its long carbon chain and multiple double bonds, indicating it is a polyunsaturated fatty acid derivative. The presence of the methoxy group and multiple methyl substituents on the aromatic ring contributes to its unique structural properties and potential biological activity. The specific configuration of the double bonds (E and Z isomers) suggests that the compound may exhibit distinct geometric isomerism, which can influence its reactivity and interactions with biological systems. This compound may be of interest in various fields, including medicinal chemistry and biochemistry, due to its potential roles in signaling pathways or as a precursor to bioactive molecules. Its stability, solubility, and reactivity would depend on the functional groups present and the overall molecular structure, making it a subject of interest for further research and application.
Formula:C21H26O3
InChI:InChI=1/C21H26O3/c1-14(8-7-9-15(2)12-21(22)23)10-11-19-16(3)13-20(24-6)18(5)17(19)4/h7-13H,1-6H3,(H,22,23)/b9-7+,11-10+,14-8-,15-12+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
