CAS 419536-33-7: [4-(9H-carbazol-9-yl)phenyl]boronic acid
Description:[4-(9H-carbazol-9-yl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a carbazole moiety. This compound typically exhibits properties such as good solubility in organic solvents and moderate stability under ambient conditions. The boronic acid group allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and materials science. The carbazole unit contributes to its electronic properties, potentially enabling applications in organic electronics, such as light-emitting diodes (OLEDs) and photovoltaic devices. Additionally, the compound may exhibit fluorescence due to the presence of the aromatic systems, which can be advantageous in sensing applications. Its molecular structure suggests potential interactions with biological systems, indicating possible applications in medicinal chemistry. Overall, [4-(9H-carbazol-9-yl)phenyl]boronic acid is a versatile compound with significant implications in both synthetic and applied chemistry.
Formula:C18H14BNO2
InChI:InChI=1/C18H14BNO2/c21-19(22)13-9-11-14(12-10-13)20-17-7-3-1-5-15(17)16-6-2-4-8-18(16)20/h1-12,21-22H
- Synonyms:
- Boronic acid, B-[4-(9H-carbazol-9-yl)phenyl]-
- B-[4-(9H-carbazol-9-yl)phenyl]-Boronic acid
- 4-(9H-Carbozol-9-yl)phenylboronic acid
- 4-(9H-carbazole-9-yl)phenylboronic acid
- 4-(9H-carbazol-9-yl) phenylboronic acid
- 4-(9H-9-carbazole)phenylboronicacid
- 4-(9H-9-carbozale)phenylboronic acid
- [4-(9H-Carbazol-9-yl)phenyl]boronic acid

4-(9H-Carbazol-9-yl)phenylboronic Acid (contains varying amounts of Anhydride)
Ref: 3B-C2926
1g | 48.00 € | ||
5g | 139.00 € |

4-(9-Carbazolyl)benzeneboronic acid, 98%
Ref: 02-H64703
1g | To inquire | ||
5g | 353.00 € |

4-(9H-Carbozol-9-yl)phenylboronic acid
Ref: IN-DA00BXR3
1g | 26.00 € | ||
5g | 36.00 € | ||
10g | 54.00 € | ||
25g | 86.00 € | ||
100g | 196.00 € |

4-(9H-Carbozol-9-yl)phenylboronic acid
Ref: 54-OR315164
1g | 32.00 € | ||
5g | 36.00 € | ||
25g | 111.00 € |

4-(9H-Carbozol-9-yl)phenylboronic acid
Ref: 10-F046987
1g | 24.00 € | ||
5g | 28.00 € | ||
10g | 46.00 € | ||
25g | 94.00 € | ||
100g | 241.00 € | ||
500g | 837.00 € |

4-(9H-Carbozol-9-yl)phenylboronic acid
Ref: 3D-URA53633
250mg | 331.00 € | ||
2500mg | 912.00 € |