
CAS 419563-23-8
:Butanedioic acid, 2,3-dihydroxy- (2S,3S)-, compd. with methyl (1R,4S)-4-amino-2-cyclopentene-1-carboxylate (1:1)
Description:
Butanedioic acid, 2,3-dihydroxy- (2S,3S)-, compd. with methyl (1R,4S)-4-amino-2-cyclopentene-1-carboxylate (1:1), identified by CAS number 419563-23-8, is a chemical compound characterized by its complex structure, which includes a butanedioic acid moiety with hydroxyl groups at the 2 and 3 positions, indicating its potential as a diol. The compound also features a methyl ester linked to a cyclopentene derivative that contains an amino group, suggesting it may exhibit biological activity or serve as a pharmaceutical intermediate. The stereochemistry indicated by the (2S,3S) and (1R,4S) designations implies specific spatial arrangements of atoms, which can significantly influence the compound's reactivity and interactions with biological systems. This compound may be of interest in medicinal chemistry due to its potential applications in drug development, particularly in the context of targeting specific biological pathways or receptors. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular structure.
Formula:C7H11NO2·C4H6O6
InChI:InChI=1S/C7H11NO2.C4H6O6/c1-10-7(9)5-2-3-6(8)4-5;5-1(3(7)8)2(6)4(9)10/h2-3,5-6H,4,8H2,1H3;1-2,5-6H,(H,7,8)(H,9,10)/t5-,6+;1-,2-/m00/s1
InChI key:InChIKey=XSEHIOOHMZAFCV-SCKHFGBISA-N
SMILES:C(OC)(=O)[C@@H]1C[C@H](N)C=C1.[C@H]([C@@H](C(O)=O)O)(C(O)=O)O
Synonyms:- Butanedioic acid, 2,3-dihydroxy- (2S,3S)-, compd. with methyl (1R,4S)-4-amino-2-cyclopentene-1-carboxylate (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(2S,3S)-2,3-Dihydroxysuccinic acid - methyl (1R,4S)-4-amino-2-cyclopentene-1-carboxylate (1:1)
CAS:Formula:C11H17NO8Purity:98%Color and Shape:SolidMolecular weight:291.2546(2S,3S)-2,3-Dihydroxybutanedioic acid methyl (1R,4S)-4-aminocyclopent-2-ene-1-carboxylate
CAS:(2S,3S)-2,3-Dihydroxybutanedioic acid methyl (1R,4S)-4-aminocyclopent-2-ene-1-carboxylatePurity:98%Molecular weight:291.25g/mol(2S,3S)-2,3-dihydroxybutanedioic acid;methyl (1R,4S)-4-aminocyclopent-2-ene-1-carboxylate
CAS:Purity:98%Molecular weight:291.256012Methyl (1R,4S)-4-Amino-2-cyclopentene-1-carboxylate (2S,3S)-2,3-Dihydroxybutanedioic Acid
CAS:Controlled Product<p>Applications Methyl (1R,4S)-4-Amino-2-cyclopentene-1-carboxylate (2S,3S)-2,3-Dihydroxybutanedioic Acid is an intermediate used in the synthesis of ent-Abacavir (A105015), which is an enatiomer of Abacavir (A105000). Abacavir is a carbocyclic 2'-deoxyguanosine nucleoside reverse transcriptase inhibitor and an anti-HIV drug used to treat HIV infection (1). Intracellular enzymes convert Abacavir to its active form, carbovir-triphosphate (CBV-TP), which then selectively inhibits HIV reverse transcriptase by incorporating into viral DNA (2). Abacavir is metabolized in the liver by uridine diphosphate glucuronyltransferase and alcohol dehydrogenase resulting in inactive glucuronide and carboxylate metabolites, respectively.<br></p>Formula:C7H11NO2·C4H6O6Color and Shape:NeatMolecular weight:291.26



