CAS 419573-18-5
:N-[[(3S,6R)-5-amino-6-[(1R,4R,6R)-4,6-diamino-3-[(2S,4S,5S)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-hydroxy-cyclohexoxy]-3-hydroxy-tetrahydropyran-2-yl]methyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]penta
Description:
The chemical substance N-[[(3S,6R)-5-amino-6-[(1R,4R,6R)-4,6-diamino-3-[(2S,4S,5S)-4-amino-3,5-dihydroxy-6-(hydroxymethyl)tetrahydropyran-2-yl]oxy-2-hydroxy-cyclohexoxy]-3-hydroxy-tetrahydropyran-2-yl]methyl]-5-[(4S)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]penta (CAS 419573-18-5) is a complex organic molecule characterized by its intricate structure, which includes multiple chiral centers and functional groups. This compound features amino, hydroxyl, and oxo groups, contributing to its potential biological activity. The presence of tetrahydropyran and thienoimidazole moieties suggests that it may interact with biological systems, possibly as a pharmaceutical agent. Its stereochemistry is significant, as the specific arrangement of atoms can influence its reactivity and interaction with biological targets. The molecular weight and solubility characteristics would depend on the specific arrangement of its functional groups, which can affect its pharmacokinetics and pharmacodynamics. Overall, this compound exemplifies the complexity often found in drug design, where structural intricacies are crucial for efficacy and safety.
Formula:C28H51N7O11S
InChI:InChI=1/C28H51N7O11S/c29-10-5-11(30)25(46-27-22(40)19(32)21(39)16(8-36)44-27)23(41)24(10)45-26-12(31)6-14(37)15(43-26)7-33-18(38)4-2-1-3-17-20-13(9-47-17)34-28(42)35-20/h10-17,19-27,36-37,39-41H,1-9,29-32H2,(H,33,38)(H2,34,35,42)/t10-,11-,12?,13?,14+,15?,16?,17+,19+,20?,21-,22?,23?,24-,25?,26-,27-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Biotinyl tobramycin amide
CAS:<p>Biotinyl tobramycin amide is a biotinylated form of the antibiotic tobramycin, which is derived from the actinobacterium Streptomyces tenebrarius. It features a tobramycin core, a potent aminoglycoside antibiotic, chemically linked to biotin. This modification allows for the specific attachment to avidin or streptavidin-labeled probes due to the strong biotin-streptavidin interaction, facilitating various labeling and detection techniques in research.</p>Formula:C28H51N7O11SPurity:Min. 95%Molecular weight:693.81 g/mol
