CAS 41961-56-2
:Macrophage Inhibitory Peptide
Description:
Macrophage Inhibitory Peptide (MIP), with the CAS number 41961-56-2, is a bioactive peptide known for its immunomodulatory properties. It is primarily involved in the regulation of macrophage activity, inhibiting their proliferation and function, which can influence inflammatory responses. MIP is often studied in the context of immune system regulation and has potential applications in therapeutic strategies for autoimmune diseases and inflammatory conditions. The peptide is characterized by its specific amino acid sequence, which contributes to its biological activity. MIP can be produced synthetically or isolated from natural sources, and its stability and solubility are influenced by its structural properties. Research into MIP continues to explore its mechanisms of action, potential side effects, and therapeutic applications, particularly in modulating immune responses in various disease states. Overall, MIP represents a significant area of interest in immunology and peptide research, highlighting the intricate interplay between peptides and immune system regulation.
Formula:C15H28N4O5
InChI:InChI=1/C15H28N4O5/c1-9(20)12(17)13(21)18-10(5-2-3-7-16)14(22)19-8-4-6-11(19)15(23)24/h9-12,20H,2-8,16-17H2,1H3,(H,18,21)(H,23,24)/t9-,10+,11+,12+/m1/s1
Synonyms:- H-Thr-Lys-Pro-OH
- L-threonyl-L-lysyl-L-proline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Macrophage Inhibitory Peptide
CAS:<p>Macrophage inhibitory peptide H-Thr-Lys-Pro-OH is a human immunoglobulin that has been shown to have antimicrobial activity against a wide range of microbes. It is asymmetric and the side chain at position Thr is protonated, while the corresponding Lys side chain is not. Macrophage inhibitory peptide H-Thr-Lys-Pro-OH binds to the acidic corneal endothelial cells, which are important for maintaining a healthy eye surface. This peptide also activates human macrophages and basic fibroblast cells and inhibits HIV infection in monoclonal antibody mice.</p>Formula:C15H28N4O5Purity:Min. 95%Molecular weight:344.41 g/mol

