CAS 41963-17-1

4-(chloromethyl)-2-(3-methylphenyl)-1,3-thiazole

Description:

4-(Chloromethyl)-2-(3-methylphenyl)-1,3-thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a chloromethyl group at the 4-position and a 3-methylphenyl group at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic ring, which can influence its solubility in organic solvents. It may also display biological activity, making it of interest in pharmaceutical research. The thiazole moiety is known for its role in various biological systems and can participate in diverse chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the compound's structure suggests potential reactivity due to the presence of the chloromethyl group, which can act as a leaving group in certain reactions. Overall, 4-(chloromethyl)-2-(3-methylphenyl)-1,3-thiazole is a versatile compound with applications in organic synthesis and medicinal chemistry.

Formula: C₁₁H₁₀ClNS

InChI: InChI=1/C11H10ClNS/c1-8-3-2-4-9(5-8)11-13-10(6-12)7-14-11/h2-5,7H,6H2,1H3

SMILES: Cc1cccc(c1)c1nc(CCl)cs1

Synonyms:

• Thiazole, 4-(Chloromethyl)-2-(3-Methylphenyl)-

4-(Chloromethyl)-2-(3-methylphenyl)-1,3-thiazole

CAS: 41963-17-1

Formula: C₁₁H₁₀ClNS

Molecular weight: 223.7218

Ref: IN-DA00C8I6

4-(chloromethyl)-2-(3-methylphenyl)-1,3-thiazole

CAS: 41963-17-1

Formula: C₁₁H₁₀ClNS

Purity: 95.0%

Molecular weight: 223.72

Ref: 10-F307669