CAS 4197-75-5

2-cyclohexylbenzene-1,4-diol

Description:

2-Cyclohexylbenzene-1,4-diol, with the CAS number 4197-75-5, is an organic compound characterized by its structure, which features a cyclohexyl group attached to a benzene ring that has hydroxyl (–OH) groups at the 1 and 4 positions. This compound is classified as a diol due to the presence of two hydroxyl functional groups, which contribute to its solubility and reactivity. The presence of the cyclohexyl group influences its physical properties, such as melting and boiling points, and can affect its hydrophobicity. 2-Cyclohexylbenzene-1,4-diol may exhibit properties typical of phenolic compounds, including antioxidant activity and potential applications in various chemical syntheses or as intermediates in organic reactions. Its specific applications and behavior in different environments can vary based on factors such as concentration, temperature, and the presence of other chemical species. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₁₆O₂

InChI: InChI=1/C12H16O2/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9/h6-9,13-14H,1-5H2

SMILES: C1CCC(CC1)c1cc(ccc1O)O

Synonyms:

• 1,4-Benzenediol, 2-Cyclohexyl-