CAS 4198-33-8
:(2S)-2-Chlorobutanedioic acid
Description:
(2S)-2-Chlorobutanedioic acid, also known as (S)-2-chlorosuccinic acid, is an organic compound characterized by its two carboxylic acid functional groups and a chlorine substituent on the second carbon of a four-carbon chain. This compound is a chiral molecule, with the (2S) designation indicating its specific stereochemistry. It typically appears as a white crystalline solid and is soluble in water due to the presence of the polar carboxylic acid groups. The chlorine atom introduces unique reactivity, allowing for potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. Its molecular structure contributes to its acidity, making it a weak acid, and it can participate in various chemical reactions, including nucleophilic substitutions and esterifications. Safety data indicates that, like many chlorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, (2S)-2-Chlorobutanedioic acid is a valuable compound in synthetic organic chemistry.
Formula:C4H5ClO4
InChI:InChI=1S/C4H5ClO4/c5-2(4(8)9)1-3(6)7/h2H,1H2,(H,6,7)(H,8,9)/t2-/m0/s1
InChI key:InChIKey=QEGKXSHUKXMDRW-REOHCLBHSA-N
SMILES:[C@H](CC(O)=O)(C(O)=O)Cl
Synonyms:- (-)-Chlorosuccinic acid
- (2S)-2-chlorobutanedioic acid
- (S)-(-)-2-Chlorosuccinic acid
- (S)-Chlorosuccinic acid
- <span class="text-smallcaps">L</span>-Chlorosuccinic acid
- Butanedioic acid, 2-chloro-, (2S)-
- Butanedioic acid, chloro-, (2S)-
- Butanedioic acid, chloro-, (S)-
- Succinic acid, chloro-, (S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

