CAS 41997-41-5

1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one

Description:

1-(2,6-Dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one, with the CAS number 41997-41-5, is an organic compound characterized by its complex structure featuring a phenylpropanone backbone. This compound contains multiple functional groups, including hydroxyl (-OH) and methoxy (-OCH3) groups, which contribute to its chemical reactivity and potential biological activity. The presence of the dihydroxy and dimethoxy substituents on the aromatic ring enhances its solubility in organic solvents and may influence its interaction with biological targets. The compound is likely to exhibit antioxidant properties due to the presence of hydroxyl groups, which can donate hydrogen atoms to free radicals. Additionally, its structural features suggest potential applications in pharmaceuticals or as a chemical intermediate in organic synthesis. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in various fields of chemistry and biochemistry.

Formula: C₁₇H₁₈O₅

InChI: InChI=1/C17H18O5/c1-21-14-10-13(19)15(16(20)17(14)22-2)12(18)9-8-11-6-4-3-5-7-11/h3-7,10,19-20H,8-9H2,1-2H3

SMILES: COc1cc(c(C(=O)CCc2ccccc2)c(c1OC)O)O

Synonyms:

• 1-Propanone, 1-(2,6-dihydroxy-3,4-dimethoxyphenyl)-3-phenyl-
• 1-(2,6-Dihydroxy-3,4-dimethoxyphenyl)-3-phenylpropan-1-one

Dihydropashanone

CAS: 41997-41-5

Dihydropashanone is a natural product of Angelica, Apiaceae.

Formula: C₁₇H₁₈O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 302.32

Ref: TM-TN3858

Dihydropashanone

CAS: 41997-41-5

Formula: C₁₇H₁₈O₅

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 302.326

Ref: BP-BP3124

Dihydropashanone

CAS: 41997-41-5

Dihydropashanone is a natural compound that is primarily classified as an antimicrobial agent. It is derived from certain plant sources, notably within a group of ethnobotanically significant flora. The compound's mode of action involves disrupting microbial cell membranes and interfering with essential enzymatic pathways, leading to the inhibition of microbial growth and proliferation.

Formula: C₁₇H₁₈O₅

Purity: Min. 95%

Molecular weight: 302.32 g/mol

Ref: 3D-RBA99741